About (R)-dibenzofuran-3-yl-(2,4-dichlorophenyl)methanol
(R)-dibenzofuran-3-yl-(2,4-dichlorophenyl)methanol (PubChem CID 100804352) has the molecular formula C19H12Cl2O2
and a molecular weight of 343.21 g/mol. Its IUPAC name is (R)-dibenzofuran-3-yl-(2,4-dichlorophenyl)methanol.
Molecular Properties
| Compound Name | (R)-dibenzofuran-3-yl-(2,4-dichlorophenyl)methanol |
| PubChem CID | 100804352 |
| Molecular Formula | C19H12Cl2O2 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | (R)-dibenzofuran-3-yl-(2,4-dichlorophenyl)methanol |
| SMILES | O[C@H](c1ccc2c(c1)oc1ccccc12)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C19H12Cl2O2/c20-12-6-8-15(16(21)10-12)19(22)11-5-7-14-13-3-1-2-4-17(13)23-18(14)9-11/h1-10,19,22H/t19-/m1/s1 |
| InChIKey | ODWWCTQTTOUQHS-LJQANCHMSA-N |
| XLogP | 5.97 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (R)-dibenzofuran-3-yl-(2,4-dichlorophenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-dibenzofuran-3-yl-(2,4-dichlorophenyl)methanol?
The IUPAC name of (R)-dibenzofuran-3-yl-(2,4-dichlorophenyl)methanol (CID 100804352) is (R)-dibenzofuran-3-yl-(2,4-dichlorophenyl)methanol.
What is the SMILES notation for (R)-dibenzofuran-3-yl-(2,4-dichlorophenyl)methanol?
The canonical SMILES for (R)-dibenzofuran-3-yl-(2,4-dichlorophenyl)methanol is O[C@H](c1ccc2c(c1)oc1ccccc12)c1ccc(Cl)cc1Cl.
What is the InChIKey of (R)-dibenzofuran-3-yl-(2,4-dichlorophenyl)methanol?
The InChIKey is ODWWCTQTTOUQHS-LJQANCHMSA-N. The full InChI is InChI=1S/C19H12Cl2O2/c20-12-6-8-15(16(21)10-12)19(22)11-5-7-14-13-3-1-2-4-17(13)23-18(14)9-11/h1-10,19,22H/t19-/m1/s1.
What are the key properties of (R)-dibenzofuran-3-yl-(2,4-dichlorophenyl)methanol?
(R)-dibenzofuran-3-yl-(2,4-dichlorophenyl)methanol has a molecular weight of 343.21 g/mol, XLogP of 5.97, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-dibenzofuran-3-yl-(2,4-dichlorophenyl)methanol is sourced from PubChem (CID 100804352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).