C18H21BrN2O2 — CID 100804512
[5-(4-amino-2-bromophenyl)furan-2-yl]-[(3S,5S)-3,5-dimethylpiperidin-1-yl]methanone (PubChem CID 100804512) has the molecular formula C18H21BrN2O2 and a molecular weight of 377.28 g/mol. Its IUPAC name is [5-(4-amino-2-bromophenyl)furan-2-yl]-[(3S,5S)-3,5-dimethylpiperidin-1-yl]methanone.
| Compound Name | [5-(4-amino-2-bromophenyl)furan-2-yl]-[(3S,5S)-3,5-dimethylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 100804512 |
| Molecular Formula | C18H21BrN2O2 |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | [5-(4-amino-2-bromophenyl)furan-2-yl]-[(3S,5S)-3,5-dimethylpiperidin-1-yl]methanone |
| SMILES | C[C@H]1C[C@H](C)CN(C(=O)c2ccc(-c3ccc(N)cc3Br)o2)C1 |
| InChI | InChI=1S/C18H21BrN2O2/c1-11-7-12(2)10-21(9-11)18(22)17-6-5-16(23-17)14-4-3-13(20)8-15(14)19/h3-6,8,11-12H,7,9-10,20H2,1-2H3/t11-,12-/m0/s1 |
| InChIKey | SGGPDFQYMLRMBQ-RYUDHWBXSA-N |
| XLogP | 4.41 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|