C19H24N2O2 — CID 100804530
[5-(3-amino-2-methylphenyl)furan-2-yl]-[(3S,5S)-3,5-dimethylpiperidin-1-yl]methanone (PubChem CID 100804530) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is [5-(3-amino-2-methylphenyl)furan-2-yl]-[(3S,5S)-3,5-dimethylpiperidin-1-yl]methanone.
| Compound Name | [5-(3-amino-2-methylphenyl)furan-2-yl]-[(3S,5S)-3,5-dimethylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 100804530 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | [5-(3-amino-2-methylphenyl)furan-2-yl]-[(3S,5S)-3,5-dimethylpiperidin-1-yl]methanone |
| SMILES | Cc1c(N)cccc1-c1ccc(C(=O)N2C[C@@H](C)C[C@H](C)C2)o1 |
| InChI | InChI=1S/C19H24N2O2/c1-12-9-13(2)11-21(10-12)19(22)18-8-7-17(23-18)15-5-4-6-16(20)14(15)3/h4-8,12-13H,9-11,20H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | VQWBTYJTAKOHCJ-STQMWFEESA-N |
| XLogP | 3.96 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|