C24H38N4O2 — CID 100806176
N-[(Z)-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-N'-[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]octanediamide (PubChem CID 100806176) has the molecular formula C24H38N4O2 and a molecular weight of 414.59 g/mol. Its IUPAC name is N-[(Z)-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-N'-[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]octanediamide.
| Compound Name | N-[(Z)-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-N'-[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]octanediamide |
|---|---|
| PubChem CID | 100806176 |
| Molecular Formula | C24H38N4O2 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | N-[(Z)-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]methylideneamino]-N'-[(Z)-[(1R,2S,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]octanediamide |
| SMILES | O=C(CCCCCCC(=O)N/N=C\[C@H]1C[C@H]2CC[C@@H]1C2)N/N=C\[C@@H]1C[C@@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C24H38N4O2/c29-23(27-25-15-21-13-17-7-9-19(21)11-17)5-3-1-2-4-6-24(30)28-26-16-22-14-18-8-10-20(22)12-18/h15-22H,1-14H2,(H,27,29)(H,28,30)/b25-15-,26-16-/t17-,18+,19-,20-,21+,22-/m1/s1 |
| InChIKey | FDSJIPNXQKFKCI-IYJYOYRESA-N |
| XLogP | 4.40 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|