C19H28N2O — CID 7438142
N-[(Z)-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]adamantane-1-carboxamide (PubChem CID 7438142) has the molecular formula C19H28N2O and a molecular weight of 300.45 g/mol. Its IUPAC name is N-[(Z)-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]adamantane-1-carboxamide.
| Compound Name | N-[(Z)-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7438142 |
| Molecular Formula | C19H28N2O |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | N-[(Z)-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]methylideneamino]adamantane-1-carboxamide |
| SMILES | O=C(N/N=C\[C@@H]1C[C@H]2CC[C@H]1C2)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H28N2O/c22-18(21-20-11-17-7-12-1-2-16(17)6-12)19-8-13-3-14(9-19)5-15(4-13)10-19/h11-17H,1-10H2,(H,21,22)/b20-11-/t12-,13?,14?,15?,16-,17-,19?/m0/s1 |
| InChIKey | FPAPEQASBSKZKC-KBCLXRJRSA-N |
| XLogP | 3.74 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|