C21H19NO5 — CID 100807424
(2-acetylphenyl) 2-[(1R,2S,6R,7R,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate (PubChem CID 100807424) has the molecular formula C21H19NO5 and a molecular weight of 365.39 g/mol. Its IUPAC name is (2-acetylphenyl) 2-[(1R,2S,6R,7R,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate.
| Compound Name | (2-acetylphenyl) 2-[(1R,2S,6R,7R,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate |
|---|---|
| PubChem CID | 100807424 |
| Molecular Formula | C21H19NO5 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | (2-acetylphenyl) 2-[(1R,2S,6R,7R,8R,10S)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetate |
| SMILES | CC(=O)c1ccccc1OC(=O)CN1C(=O)[C@@H]2[C@@H]3C=C[C@H]([C@H]4C[C@@H]34)[C@@H]2C1=O |
| InChI | InChI=1S/C21H19NO5/c1-10(23)11-4-2-3-5-16(11)27-17(24)9-22-20(25)18-12-6-7-13(15-8-14(12)15)19(18)21(22)26/h2-7,12-15,18-19H,8-9H2,1H3/t12-,13-,14-,15+,18+,19-/m1/s1 |
| InChIKey | LHGJBCACLIKDFZ-IZXHFZDPSA-N |
| XLogP | 1.85 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|