C26H21NO6 — CID 124763054
phenyl 2-[2-[(1S,2R,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetyl]oxybenzoate (PubChem CID 124763054) has the molecular formula C26H21NO6 and a molecular weight of 443.46 g/mol. Its IUPAC name is phenyl 2-[2-[(1S,2R,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetyl]oxybenzoate.
| Compound Name | phenyl 2-[2-[(1S,2R,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetyl]oxybenzoate |
|---|---|
| PubChem CID | 124763054 |
| Molecular Formula | C26H21NO6 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | phenyl 2-[2-[(1S,2R,6R,7S,8R,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]acetyl]oxybenzoate |
| SMILES | O=C(CN1C(=O)[C@@H]2[C@H]3C=C[C@@H]([C@@H]4C[C@@H]34)[C@H]2C1=O)Oc1ccccc1C(=O)Oc1ccccc1 |
| InChI | InChI=1S/C26H21NO6/c28-21(33-20-9-5-4-8-17(20)26(31)32-14-6-2-1-3-7-14)13-27-24(29)22-15-10-11-16(19-12-18(15)19)23(22)25(27)30/h1-11,15-16,18-19,22-23H,12-13H2/t15-,16-,18-,19-,22+,23+/m0/s1 |
| InChIKey | QJUQTUHYQBIKIC-JYKFVMEGSA-N |
| XLogP | 2.86 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|