C27H26N2O4 — CID 100807917
N-[[(1R,2R,6S,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-3-methoxy-N-(4-methylphenyl)benzamide (PubChem CID 100807917) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is N-[[(1R,2R,6S,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-3-methoxy-N-(4-methylphenyl)benzamide.
| Compound Name | N-[[(1R,2R,6S,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-3-methoxy-N-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 100807917 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-[[(1R,2R,6S,7R,8S,10R)-3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl]methyl]-3-methoxy-N-(4-methylphenyl)benzamide |
| SMILES | COc1cccc(C(=O)N(CN2C(=O)[C@@H]3[C@@H]4C=C[C@H]([C@H]5C[C@@H]45)[C@@H]3C2=O)c2ccc(C)cc2)c1 |
| InChI | InChI=1S/C27H26N2O4/c1-15-6-8-17(9-7-15)28(25(30)16-4-3-5-18(12-16)33-2)14-29-26(31)23-19-10-11-20(22-13-21(19)22)24(23)27(29)32/h3-12,19-24H,13-14H2,1-2H3/t19-,20-,21-,22+,23+,24-/m1/s1 |
| InChIKey | QJZWTKQQZUCRIR-WVYLNQBTSA-N |
| XLogP | 3.66 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|