C27H25ClN2O4 — CID 19646440
N-(5-chloro-2-methylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-3-methoxybenzamide (PubChem CID 19646440) has the molecular formula C27H25ClN2O4 and a molecular weight of 476.96 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-3-methoxybenzamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 19646440 |
| Molecular Formula | C27H25ClN2O4 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-N-[(3,5-dioxo-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-en-4-yl)methyl]-3-methoxybenzamide |
| SMILES | COc1cccc(C(=O)N(CN2C(=O)C3C4C=CC(C5CC45)C3C2=O)c2cc(Cl)ccc2C)c1 |
| InChI | InChI=1S/C27H25ClN2O4/c1-14-6-7-16(28)11-22(14)29(25(31)15-4-3-5-17(10-15)34-2)13-30-26(32)23-18-8-9-19(21-12-20(18)21)24(23)27(30)33/h3-11,18-21,23-24H,12-13H2,1-2H3 |
| InChIKey | LFRNVYSIKOUEAW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|