C10H14O3 — CID 10081063
3-(113C)ethyl-4-[(2-methylpropan-2-yl)oxy]cyclobut-3-ene-1,2-dione (PubChem CID 10081063) has the molecular formula C10H14O3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-(113C)ethyl-4-[(2-methylpropan-2-yl)oxy]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-(113C)ethyl-4-[(2-methylpropan-2-yl)oxy]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 10081063 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 3-(113C)ethyl-4-[(2-methylpropan-2-yl)oxy]cyclobut-3-ene-1,2-dione |
| SMILES | C[13CH2]c1c(OC(C)(C)C)c(=O)c1=O |
| InChI | InChI=1S/C10H14O3/c1-5-6-7(11)8(12)9(6)13-10(2,3)4/h5H2,1-4H3/i5+1 |
| InChIKey | AXXVAJYNCKRMAO-HOSYLAQJSA-N |
| XLogP | 1.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|