C9H16N2S — CID 10081096
4,5-dipropyl-1,3-dihydroimidazole-2-thione (PubChem CID 10081096) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is 4,5-dipropyl-1,3-dihydroimidazole-2-thione.
| Compound Name | 4,5-dipropyl-1,3-dihydroimidazole-2-thione |
|---|---|
| PubChem CID | 10081096 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 4,5-dipropyl-1,3-dihydroimidazole-2-thione |
| SMILES | CCCc1[nH]c(=S)[nH]c1CCC |
| InChI | InChI=1S/C9H16N2S/c1-3-5-7-8(6-4-2)11-9(12)10-7/h3-6H2,1-2H3,(H2,10,11,12) |
| InChIKey | GIJPDHWWYVBUMH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|