C15H18N4O2S — CID 100815742
(5R)-5-methyl-N-(3-pyrazol-1-ylpropyl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide (PubChem CID 100815742) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is (5R)-5-methyl-N-(3-pyrazol-1-ylpropyl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide.
| Compound Name | (5R)-5-methyl-N-(3-pyrazol-1-ylpropyl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 100815742 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | (5R)-5-methyl-N-(3-pyrazol-1-ylpropyl)-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide |
| SMILES | C[C@]1(C(=O)NCCCn2cccn2)CC(c2cccs2)=NO1 |
| InChI | InChI=1S/C15H18N4O2S/c1-15(11-12(18-21-15)13-5-2-10-22-13)14(20)16-6-3-8-19-9-4-7-17-19/h2,4-5,7,9-10H,3,6,8,11H2,1H3,(H,16,20)/t15-/m1/s1 |
| InChIKey | AUHFCZCNSFBZKO-OAHLLOKOSA-N |
| XLogP | 2.03 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|