C15H21N3O4S — CID 102551896
N-[3-(2-methoxyethylamino)-3-oxopropyl]-5-methyl-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide (PubChem CID 102551896) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is N-[3-(2-methoxyethylamino)-3-oxopropyl]-5-methyl-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide.
| Compound Name | N-[3-(2-methoxyethylamino)-3-oxopropyl]-5-methyl-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 102551896 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | N-[3-(2-methoxyethylamino)-3-oxopropyl]-5-methyl-3-thiophen-2-yl-4H-1,2-oxazole-5-carboxamide |
| SMILES | COCCNC(=O)CCNC(=O)C1(C)CC(c2cccs2)=NO1 |
| InChI | InChI=1S/C15H21N3O4S/c1-15(10-11(18-22-15)12-4-3-9-23-12)14(20)17-6-5-13(19)16-7-8-21-2/h3-4,9H,5-8,10H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | WKMMRADXHFROHA-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|