C22H29N5O3S2 — CID 30126247
2-[4-[2-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 30126247) has the molecular formula C22H29N5O3S2 and a molecular weight of 475.64 g/mol. Its IUPAC name is 2-[4-[2-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[4-[2-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 30126247 |
| Molecular Formula | C22H29N5O3S2 |
| Molecular Weight | 475.64 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 2-[4-[2-[(3R)-3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-oxoethyl]piperazin-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1CCN(CC(=O)N2N=C(c3cccs3)C[C@@H]2c2cccs2)CC1 |
| InChI | InChI=1S/C22H29N5O3S2/c1-30-11-6-23-21(28)15-25-7-9-26(10-8-25)16-22(29)27-18(20-5-3-13-32-20)14-17(24-27)19-4-2-12-31-19/h2-5,12-13,18H,6-11,14-16H2,1H3,(H,23,28)/t18-/m1/s1 |
| InChIKey | CDHMEFHJXQMKFS-GOSISDBHSA-N |
| XLogP | 1.87 |
| TPSA | 77.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.64 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|