C25H28N4O2S2 — CID 55830854
1-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone (PubChem CID 55830854) has the molecular formula C25H28N4O2S2 and a molecular weight of 480.66 g/mol. Its IUPAC name is 1-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone.
| Compound Name | 1-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 55830854 |
| Molecular Formula | C25H28N4O2S2 |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 1-(3,5-dithiophen-2-yl-3,4-dihydropyrazol-2-yl)-2-[4-(4-methoxyphenyl)-1,4-diazepan-1-yl]ethanone |
| SMILES | COc1ccc(N2CCCN(CC(=O)N3N=C(c4cccs4)CC3c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C25H28N4O2S2/c1-31-20-9-7-19(8-10-20)28-12-4-11-27(13-14-28)18-25(30)29-22(24-6-3-16-33-24)17-21(26-29)23-5-2-15-32-23/h2-3,5-10,15-16,22H,4,11-14,17-18H2,1H3 |
| InChIKey | HMCCLCNMIRQBGA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 48.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|