C12H9BrN2O5 — CID 100818199
5-[2-(4-bromophenyl)-2-oxoethyl]-5-hydroxy-1,3-diazinane-2,4,6-trione (PubChem CID 100818199) has the molecular formula C12H9BrN2O5 and a molecular weight of 341.12 g/mol. Its IUPAC name is 5-[2-(4-bromophenyl)-2-oxoethyl]-5-hydroxy-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[2-(4-bromophenyl)-2-oxoethyl]-5-hydroxy-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 100818199 |
| Molecular Formula | C12H9BrN2O5 |
| Molecular Weight | 341.12 g/mol |
| Exact Mass | 339.97 |
| IUPAC Name | 5-[2-(4-bromophenyl)-2-oxoethyl]-5-hydroxy-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)C(O)(CC(=O)c2ccc(Br)cc2)C(=O)N1 |
| InChI | InChI=1S/C12H9BrN2O5/c13-7-3-1-6(2-4-7)8(16)5-12(20)9(17)14-11(19)15-10(12)18/h1-4,20H,5H2,(H2,14,15,17,18,19) |
| InChIKey | UQVHMYCNXGZRPS-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.12 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|