C27H27F6N3O5S2 — CID 100818382
tert-butyl N-[(2R)-1-[[(3aS,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 100818382) has the molecular formula C27H27F6N3O5S2 and a molecular weight of 651.65 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[[(3aS,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[[(3aS,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 100818382 |
| Molecular Formula | C27H27F6N3O5S2 |
| Molecular Weight | 651.65 g/mol |
| Exact Mass | 651.13 |
| IUPAC Name | tert-butyl N-[(2R)-1-[[(3aS,6aS)-3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccccc1)C(=O)/N=C1\S[C@@H]2CS(=O)(=O)C[C@@H]2N1c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H27F6N3O5S2/c1-25(2,3)41-24(38)34-19(9-15-7-5-4-6-8-15)22(37)35-23-36(20-13-43(39,40)14-21(20)42-23)18-11-16(26(28,29)30)10-17(12-18)27(31,32)33/h4-8,10-12,19-21H,9,13-14H2,1-3H3,(H,34,38)/b35-23-/t19-,20+,21-/m1/s1 |
| InChIKey | YFQVWLICYWSJBN-NBXQTEIYSA-N |
| XLogP | 5.46 |
| TPSA | 105.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.65 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|