C26H28F3N3O6S2 — CID 98192157
tert-butyl N-[(2S)-1-[[(3aS,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 98192157) has the molecular formula C26H28F3N3O6S2 and a molecular weight of 599.65 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(3aS,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(3aS,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 98192157 |
| Molecular Formula | C26H28F3N3O6S2 |
| Molecular Weight | 599.65 g/mol |
| Exact Mass | 599.14 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(3aS,6aR)-5,5-dioxo-3-[4-(trifluoromethoxy)phenyl]-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccccc1)C(=O)/N=C1\S[C@H]2CS(=O)(=O)C[C@@H]2N1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C26H28F3N3O6S2/c1-25(2,3)38-24(34)30-19(13-16-7-5-4-6-8-16)22(33)31-23-32(20-14-40(35,36)15-21(20)39-23)17-9-11-18(12-10-17)37-26(27,28)29/h4-12,19-21H,13-15H2,1-3H3,(H,30,34)/b31-23-/t19-,20-,21-/m0/s1 |
| InChIKey | OLYCYHZFPVRZRF-OCCJLPCCSA-N |
| XLogP | 4.32 |
| TPSA | 114.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.65 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|