C30H24N2O6S — CID 100819157
[2-[(3R,3aS,6aR)-5-benzyl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate (PubChem CID 100819157) has the molecular formula C30H24N2O6S and a molecular weight of 540.60 g/mol. Its IUPAC name is [2-[(3R,3aS,6aR)-5-benzyl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate.
| Compound Name | [2-[(3R,3aS,6aR)-5-benzyl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 100819157 |
| Molecular Formula | C30H24N2O6S |
| Molecular Weight | 540.60 g/mol |
| Exact Mass | 540.14 |
| IUPAC Name | [2-[(3R,3aS,6aR)-5-benzyl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate |
| SMILES | O=C1[C@@H]2[C@@H](ON(c3ccccc3)[C@H]2c2ccccc2OS(=O)(=O)c2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C30H24N2O6S/c33-29-26-27(24-18-10-11-19-25(24)38-39(35,36)23-16-8-3-9-17-23)32(22-14-6-2-7-15-22)37-28(26)30(34)31(29)20-21-12-4-1-5-13-21/h1-19,26-28H,20H2/t26-,27-,28+/m0/s1 |
| InChIKey | MMARDNUAGBVHGL-HZFUHODCSA-N |
| XLogP | 4.50 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|