C29H20Cl2N2O6S — CID 2066992
[2-[(3R,3aS,6aR)-5-(3,4-dichlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate (PubChem CID 2066992) has the molecular formula C29H20Cl2N2O6S and a molecular weight of 595.46 g/mol. Its IUPAC name is [2-[(3R,3aS,6aR)-5-(3,4-dichlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate.
| Compound Name | [2-[(3R,3aS,6aR)-5-(3,4-dichlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 2066992 |
| Molecular Formula | C29H20Cl2N2O6S |
| Molecular Weight | 595.46 g/mol |
| Exact Mass | 594.04 |
| IUPAC Name | [2-[(3R,3aS,6aR)-5-(3,4-dichlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate |
| SMILES | O=C1[C@@H]2[C@@H](ON(c3ccccc3)[C@H]2c2ccccc2OS(=O)(=O)c2ccccc2)C(=O)N1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H20Cl2N2O6S/c30-22-16-15-19(17-23(22)31)32-28(34)25-26(33(38-27(25)29(32)35)18-9-3-1-4-10-18)21-13-7-8-14-24(21)39-40(36,37)20-11-5-2-6-12-20/h1-17,25-27H/t25-,26-,27+/m0/s1 |
| InChIKey | JSTBIZGEHTYPEI-GMQQYTKMSA-N |
| XLogP | 5.81 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.46 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|