C29H21ClN2O6S — CID 98380721
[4-[(3R,3aR,6aR)-5-(4-chlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate (PubChem CID 98380721) has the molecular formula C29H21ClN2O6S and a molecular weight of 561.02 g/mol. Its IUPAC name is [4-[(3R,3aR,6aR)-5-(4-chlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate.
| Compound Name | [4-[(3R,3aR,6aR)-5-(4-chlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 98380721 |
| Molecular Formula | C29H21ClN2O6S |
| Molecular Weight | 561.02 g/mol |
| Exact Mass | 560.08 |
| IUPAC Name | [4-[(3R,3aR,6aR)-5-(4-chlorophenyl)-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate |
| SMILES | O=C1[C@H]2[C@@H](ON(c3ccccc3)[C@H]2c2ccc(OS(=O)(=O)c3ccccc3)cc2)C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H21ClN2O6S/c30-20-13-15-21(16-14-20)31-28(33)25-26(32(37-27(25)29(31)34)22-7-3-1-4-8-22)19-11-17-23(18-12-19)38-39(35,36)24-9-5-2-6-10-24/h1-18,25-27H/t25-,26+,27-/m1/s1 |
| InChIKey | UKRDWDBPEWEPTA-KWXIBIRDSA-N |
| XLogP | 5.16 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.02 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|