C33H24N2O6S — CID 98382686
[4-[(3S,3aR,6aR)-5-naphthalen-1-yl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate (PubChem CID 98382686) has the molecular formula C33H24N2O6S and a molecular weight of 576.63 g/mol. Its IUPAC name is [4-[(3S,3aR,6aR)-5-naphthalen-1-yl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate.
| Compound Name | [4-[(3S,3aR,6aR)-5-naphthalen-1-yl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 98382686 |
| Molecular Formula | C33H24N2O6S |
| Molecular Weight | 576.63 g/mol |
| Exact Mass | 576.14 |
| IUPAC Name | [4-[(3S,3aR,6aR)-5-naphthalen-1-yl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate |
| SMILES | O=C1[C@@H]2[C@@H](c3ccc(OS(=O)(=O)c4ccccc4)cc3)N(c3ccccc3)O[C@H]2C(=O)N1c1cccc2ccccc12 |
| InChI | InChI=1S/C33H24N2O6S/c36-32-29-30(23-18-20-25(21-19-23)41-42(38,39)26-14-5-2-6-15-26)35(24-12-3-1-4-13-24)40-31(29)33(37)34(32)28-17-9-11-22-10-7-8-16-27(22)28/h1-21,29-31H/t29-,30-,31-/m1/s1 |
| InChIKey | ULDGKVJMNWIMNF-JFHPUIQFSA-N |
| XLogP | 5.66 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.63 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|