C29H21N3O8S — CID 98325518
[4-[(3R,3aS,6aS)-2-(3-nitrophenyl)-4,6-dioxo-5-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate (PubChem CID 98325518) has the molecular formula C29H21N3O8S and a molecular weight of 571.57 g/mol. Its IUPAC name is [4-[(3R,3aS,6aS)-2-(3-nitrophenyl)-4,6-dioxo-5-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate.
| Compound Name | [4-[(3R,3aS,6aS)-2-(3-nitrophenyl)-4,6-dioxo-5-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 98325518 |
| Molecular Formula | C29H21N3O8S |
| Molecular Weight | 571.57 g/mol |
| Exact Mass | 571.10 |
| IUPAC Name | [4-[(3R,3aS,6aS)-2-(3-nitrophenyl)-4,6-dioxo-5-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate |
| SMILES | O=C1[C@@H]2[C@H](ON(c3cccc([N+](=O)[O-])c3)[C@H]2c2ccc(OS(=O)(=O)c3ccccc3)cc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C29H21N3O8S/c33-28-25-26(19-14-16-23(17-15-19)40-41(37,38)24-12-5-2-6-13-24)31(21-10-7-11-22(18-21)32(35)36)39-27(25)29(34)30(28)20-8-3-1-4-9-20/h1-18,25-27H/t25-,26-,27-/m0/s1 |
| InChIKey | NVNKPUXJRAPYLI-QKDODKLFSA-N |
| XLogP | 4.41 |
| TPSA | 136.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|