C29H20ClN3O8S — CID 98714221
[4-[(3S,3aS,6aR)-5-(4-chlorophenyl)-2-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate (PubChem CID 98714221) has the molecular formula C29H20ClN3O8S and a molecular weight of 606.01 g/mol. Its IUPAC name is [4-[(3S,3aS,6aR)-5-(4-chlorophenyl)-2-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate.
| Compound Name | [4-[(3S,3aS,6aR)-5-(4-chlorophenyl)-2-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 98714221 |
| Molecular Formula | C29H20ClN3O8S |
| Molecular Weight | 606.01 g/mol |
| Exact Mass | 605.07 |
| IUPAC Name | [4-[(3S,3aS,6aR)-5-(4-chlorophenyl)-2-(3-nitrophenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]phenyl] benzenesulfonate |
| SMILES | O=C1[C@H]2[C@@H](c3ccc(OS(=O)(=O)c4ccccc4)cc3)N(c3cccc([N+](=O)[O-])c3)O[C@H]2C(=O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H20ClN3O8S/c30-19-11-13-20(14-12-19)31-28(34)25-26(32(40-27(25)29(31)35)21-5-4-6-22(17-21)33(36)37)18-9-15-23(16-10-18)41-42(38,39)24-7-2-1-3-8-24/h1-17,25-27H/t25-,26+,27+/m0/s1 |
| InChIKey | ZOBFGCHQGWUOAD-OYUWMTPXSA-N |
| XLogP | 5.07 |
| TPSA | 136.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.01 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|