C28H19N3O3 — CID 100888078
4-[(3S,3aS,6aS)-5-naphthalen-1-yl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzonitrile (PubChem CID 100888078) has the molecular formula C28H19N3O3 and a molecular weight of 445.48 g/mol. Its IUPAC name is 4-[(3S,3aS,6aS)-5-naphthalen-1-yl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzonitrile.
| Compound Name | 4-[(3S,3aS,6aS)-5-naphthalen-1-yl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 100888078 |
| Molecular Formula | C28H19N3O3 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 4-[(3S,3aS,6aS)-5-naphthalen-1-yl-4,6-dioxo-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-3-yl]benzonitrile |
| SMILES | N#Cc1ccc([C@@H]2[C@@H]3C(=O)N(c4cccc5ccccc45)C(=O)[C@H]3ON2c2ccccc2)cc1 |
| InChI | InChI=1S/C28H19N3O3/c29-17-18-13-15-20(16-14-18)25-24-26(34-31(25)21-9-2-1-3-10-21)28(33)30(27(24)32)23-12-6-8-19-7-4-5-11-22(19)23/h1-16,24-26H/t24-,25+,26-/m0/s1 |
| InChIKey | AKUJOPCVVSTSBO-NXCFDTQHSA-N |
| XLogP | 4.76 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|