C18H19NO6S — CID 100820243
3-[(2-carboxyphenyl)-propylsulfamoyl]-4-methylbenzoic acid (PubChem CID 100820243) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is 3-[(2-carboxyphenyl)-propylsulfamoyl]-4-methylbenzoic acid.
| Compound Name | 3-[(2-carboxyphenyl)-propylsulfamoyl]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 100820243 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 3-[(2-carboxyphenyl)-propylsulfamoyl]-4-methylbenzoic acid |
| SMILES | CCCN(c1ccccc1C(=O)O)S(=O)(=O)c1cc(C(=O)O)ccc1C |
| InChI | InChI=1S/C18H19NO6S/c1-3-10-19(15-7-5-4-6-14(15)18(22)23)26(24,25)16-11-13(17(20)21)9-8-12(16)2/h4-9,11H,3,10H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | AJEOMHIUYMFWTO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |