C34H30N2O4 — CID 100823124
[4-(2-phenylpropan-2-yl)phenyl] (3aR,4S,9bR)-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate (PubChem CID 100823124) has the molecular formula C34H30N2O4 and a molecular weight of 530.62 g/mol. Its IUPAC name is [4-(2-phenylpropan-2-yl)phenyl] (3aR,4S,9bR)-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate.
| Compound Name | [4-(2-phenylpropan-2-yl)phenyl] (3aR,4S,9bR)-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 100823124 |
| Molecular Formula | C34H30N2O4 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | [4-(2-phenylpropan-2-yl)phenyl] (3aR,4S,9bR)-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxylate |
| SMILES | CC(C)(c1ccccc1)c1ccc(OC(=O)c2ccc3c(c2)[C@@H]2C=CC[C@H]2[C@@H](c2ccc([N+](=O)[O-])cc2)N3)cc1 |
| InChI | InChI=1S/C34H30N2O4/c1-34(2,24-7-4-3-5-8-24)25-14-18-27(19-15-25)40-33(37)23-13-20-31-30(21-23)28-9-6-10-29(28)32(35-31)22-11-16-26(17-12-22)36(38)39/h3-9,11-21,28-29,32,35H,10H2,1-2H3/t28-,29-,32-/m1/s1 |
| InChIKey | YCJJYVRHQNLDFK-MZMMNKLXSA-N |
| XLogP | 7.97 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|