C25H20INO2 — CID 3330614
[4-(8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenyl] benzoate (PubChem CID 3330614) has the molecular formula C25H20INO2 and a molecular weight of 493.34 g/mol. Its IUPAC name is [4-(8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenyl] benzoate.
| Compound Name | [4-(8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenyl] benzoate |
|---|---|
| PubChem CID | 3330614 |
| Molecular Formula | C25H20INO2 |
| Molecular Weight | 493.34 g/mol |
| Exact Mass | 493.05 |
| IUPAC Name | [4-(8-iodo-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)phenyl] benzoate |
| SMILES | O=C(Oc1ccc(C2Nc3ccc(I)cc3C3C=CCC32)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H20INO2/c26-18-11-14-23-22(15-18)20-7-4-8-21(20)24(27-23)16-9-12-19(13-10-16)29-25(28)17-5-2-1-3-6-17/h1-7,9-15,20-21,24,27H,8H2 |
| InChIKey | UWYLVCMDQQZFDW-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.34 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|