C37H24Cl4N2O10 — CID 100824102
[(2S,3R,4S,5R)-3,4-dibenzoyloxy-5-[3-(2,4-dichlorobenzoyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl 2,4-dichlorobenzoate (PubChem CID 100824102) has the molecular formula C37H24Cl4N2O10 and a molecular weight of 798.42 g/mol. Its IUPAC name is [(2S,3R,4S,5R)-3,4-dibenzoyloxy-5-[3-(2,4-dichlorobenzoyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl 2,4-dichlorobenzoate.
| Compound Name | [(2S,3R,4S,5R)-3,4-dibenzoyloxy-5-[3-(2,4-dichlorobenzoyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 100824102 |
| Molecular Formula | C37H24Cl4N2O10 |
| Molecular Weight | 798.42 g/mol |
| Exact Mass | 796.02 |
| IUPAC Name | [(2S,3R,4S,5R)-3,4-dibenzoyloxy-5-[3-(2,4-dichlorobenzoyl)-2,4-dioxopyrimidin-1-yl]oxolan-2-yl]methyl 2,4-dichlorobenzoate |
| SMILES | O=C(O[C@H]1[C@H](OC(=O)c2ccccc2)[C@H](n2ccc(=O)n(C(=O)c3ccc(Cl)cc3Cl)c2=O)O[C@H]1COC(=O)c1ccc(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C37H24Cl4N2O10/c38-22-11-13-24(26(40)17-22)32(45)43-29(44)15-16-42(37(43)49)33-31(53-35(47)21-9-5-2-6-10-21)30(52-34(46)20-7-3-1-4-8-20)28(51-33)19-50-36(48)25-14-12-23(39)18-27(25)41/h1-18,28,30-31,33H,19H2/t28-,30+,31-,33+/m0/s1 |
| InChIKey | KDBQFXMDMGBEAW-KBXBXOKJSA-N |
| XLogP | 6.52 |
| TPSA | 149.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.42 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|