C8H9BrO3 — CID 10082697
(3aS,5S,7aR)-7-bromo-5-methyl-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-2-one (PubChem CID 10082697) has the molecular formula C8H9BrO3 and a molecular weight of 233.06 g/mol. Its IUPAC name is (3aS,5S,7aR)-7-bromo-5-methyl-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-2-one.
| Compound Name | (3aS,5S,7aR)-7-bromo-5-methyl-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 10082697 |
| Molecular Formula | C8H9BrO3 |
| Molecular Weight | 233.06 g/mol |
| Exact Mass | 231.97 |
| IUPAC Name | (3aS,5S,7aR)-7-bromo-5-methyl-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-2-one |
| SMILES | C[C@H]1C=C(Br)[C@@H]2OC(=O)C[C@@H]2O1 |
| InChI | InChI=1S/C8H9BrO3/c1-4-2-5(9)8-6(11-4)3-7(10)12-8/h2,4,6,8H,3H2,1H3/t4-,6-,8-/m0/s1 |
| InChIKey | CUGYWRJODFARAE-WSDOSGOUSA-N |
| XLogP | 1.37 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.06 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |