C7H8O3 — CID 14139064
(3aS,7aS)-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-2-one (PubChem CID 14139064) has the molecular formula C7H8O3 and a molecular weight of 140.14 g/mol. Its IUPAC name is (3aS,7aS)-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-2-one.
| Compound Name | (3aS,7aS)-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-2-one |
|---|---|
| PubChem CID | 14139064 |
| Molecular Formula | C7H8O3 |
| Molecular Weight | 140.14 g/mol |
| Exact Mass | 140.05 |
| IUPAC Name | (3aS,7aS)-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-2-one |
| SMILES | O=C1C[C@@H]2OCC=C[C@@H]2O1 |
| InChI | InChI=1S/C7H8O3/c8-7-4-6-5(10-7)2-1-3-9-6/h1-2,5-6H,3-4H2/t5-,6-/m0/s1 |
| InChIKey | WCQRYYZUPNSSCS-WDSKDSINSA-N |
| XLogP | 0.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.14 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|