C8H8O4 — CID 44519379
(3aS,5R,7aS)-2-oxo-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-5-carbaldehyde (PubChem CID 44519379) has the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. Its IUPAC name is (3aS,5R,7aS)-2-oxo-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-5-carbaldehyde.
| Compound Name | (3aS,5R,7aS)-2-oxo-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-5-carbaldehyde |
|---|---|
| PubChem CID | 44519379 |
| Molecular Formula | C8H8O4 |
| Molecular Weight | 168.15 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (3aS,5R,7aS)-2-oxo-3,3a,5,7a-tetrahydrofuro[3,2-b]pyran-5-carbaldehyde |
| SMILES | O=C[C@H]1C=C[C@@H]2OC(=O)C[C@@H]2O1 |
| InChI | InChI=1S/C8H8O4/c9-4-5-1-2-6-7(11-5)3-8(10)12-6/h1-2,4-7H,3H2/t5-,6+,7+/m1/s1 |
| InChIKey | LMUKROVAHVTPFX-VQVTYTSYSA-N |
| XLogP | -0.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.15 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|