C12H16O5 — CID 25210041
[(Z,1R)-1-[(2S,3S)-3-formyloxiran-2-yl]-4-prop-2-enoxybut-2-enyl] acetate (PubChem CID 25210041) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is [(Z,1R)-1-[(2S,3S)-3-formyloxiran-2-yl]-4-prop-2-enoxybut-2-enyl] acetate.
| Compound Name | [(Z,1R)-1-[(2S,3S)-3-formyloxiran-2-yl]-4-prop-2-enoxybut-2-enyl] acetate |
|---|---|
| PubChem CID | 25210041 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | [(Z,1R)-1-[(2S,3S)-3-formyloxiran-2-yl]-4-prop-2-enoxybut-2-enyl] acetate |
| SMILES | C=CCOC/C=C\[C@@H](OC(C)=O)[C@@H]1O[C@@H]1C=O |
| InChI | InChI=1S/C12H16O5/c1-3-6-15-7-4-5-10(16-9(2)14)12-11(8-13)17-12/h3-5,8,10-12H,1,6-7H2,2H3/b5-4-/t10-,11-,12+/m1/s1 |
| InChIKey | MMGCUBAUXNSZDW-UMOJZNBSSA-N |
| XLogP | 0.64 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|