C15H20O5 — CID 71552035
methyl (5S,9E,12Z)-3-oxo-4,15-dioxabicyclo[12.1.0]pentadeca-9,12-diene-5-carboxylate (PubChem CID 71552035) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl (5S,9E,12Z)-3-oxo-4,15-dioxabicyclo[12.1.0]pentadeca-9,12-diene-5-carboxylate.
| Compound Name | methyl (5S,9E,12Z)-3-oxo-4,15-dioxabicyclo[12.1.0]pentadeca-9,12-diene-5-carboxylate |
|---|---|
| PubChem CID | 71552035 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | methyl (5S,9E,12Z)-3-oxo-4,15-dioxabicyclo[12.1.0]pentadeca-9,12-diene-5-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC/C=C/C/C=C\C2OC2CC(=O)O1 |
| InChI | InChI=1S/C15H20O5/c1-18-15(17)12-9-7-5-3-2-4-6-8-11-13(19-11)10-14(16)20-12/h2-3,6,8,11-13H,4-5,7,9-10H2,1H3/b3-2+,8-6-/t11?,12-,13?/m0/s1 |
| InChIKey | PAWNIXGSPGYTKY-RJRPDRGMSA-N |
| XLogP | 1.92 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|