C13H20O4 — CID 54308981
ethyl 7-[(2S,3R)-3-ethyloxiran-2-yl]-3-oxohept-6-enoate (PubChem CID 54308981) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is ethyl 7-[(2S,3R)-3-ethyloxiran-2-yl]-3-oxohept-6-enoate.
| Compound Name | ethyl 7-[(2S,3R)-3-ethyloxiran-2-yl]-3-oxohept-6-enoate |
|---|---|
| PubChem CID | 54308981 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | ethyl 7-[(2S,3R)-3-ethyloxiran-2-yl]-3-oxohept-6-enoate |
| SMILES | CCOC(=O)CC(=O)CCC=C[C@@H]1O[C@@H]1CC |
| InChI | InChI=1S/C13H20O4/c1-3-11-12(17-11)8-6-5-7-10(14)9-13(15)16-4-2/h6,8,11-12H,3-5,7,9H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | SJOFWBZNNGMDJW-NEPJUHHUSA-N |
| XLogP | 2.02 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|