About 3,3a-dihydrofuro[3,2-b]pyran-2-one
3,3a-dihydrofuro[3,2-b]pyran-2-one (PubChem CID 171665631) has the molecular formula C7H6O3
and a molecular weight of 138.12 g/mol. Its IUPAC name is 3,3a-dihydrofuro[3,2-b]pyran-2-one.
Molecular Properties
| Compound Name | 3,3a-dihydrofuro[3,2-b]pyran-2-one |
| PubChem CID | 171665631 |
| Molecular Formula | C7H6O3 |
| Molecular Weight | 138.12 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | 3,3a-dihydrofuro[3,2-b]pyran-2-one |
| SMILES | O=C1CC2OC=CC=C2O1 |
| InChI | InChI=1S/C7H6O3/c8-7-4-6-5(10-7)2-1-3-9-6/h1-3,6H,4H2 |
| InChIKey | MOLIVXNITHHZRP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.12 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,3a-dihydrofuro[3,2-b]pyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3a-dihydrofuro[3,2-b]pyran-2-one?
The IUPAC name of 3,3a-dihydrofuro[3,2-b]pyran-2-one (CID 171665631) is 3,3a-dihydrofuro[3,2-b]pyran-2-one.
What is the SMILES notation for 3,3a-dihydrofuro[3,2-b]pyran-2-one?
The canonical SMILES for 3,3a-dihydrofuro[3,2-b]pyran-2-one is O=C1CC2OC=CC=C2O1.
What is the InChIKey of 3,3a-dihydrofuro[3,2-b]pyran-2-one?
The InChIKey is MOLIVXNITHHZRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3/c8-7-4-6-5(10-7)2-1-3-9-6/h1-3,6H,4H2.
What are the key properties of 3,3a-dihydrofuro[3,2-b]pyran-2-one?
3,3a-dihydrofuro[3,2-b]pyran-2-one has a molecular weight of 138.12 g/mol, XLogP of 0.73, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3a-dihydrofuro[3,2-b]pyran-2-one is sourced from PubChem (CID 171665631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).