C22H22N6OS — CID 100828070
3-(2-methylimidazo[1,2-a]pyridin-3-yl)-6-[(5-methyl-2-propan-2-ylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 100828070) has the molecular formula C22H22N6OS and a molecular weight of 418.53 g/mol. Its IUPAC name is 3-(2-methylimidazo[1,2-a]pyridin-3-yl)-6-[(5-methyl-2-propan-2-ylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(2-methylimidazo[1,2-a]pyridin-3-yl)-6-[(5-methyl-2-propan-2-ylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 100828070 |
| Molecular Formula | C22H22N6OS |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 3-(2-methylimidazo[1,2-a]pyridin-3-yl)-6-[(5-methyl-2-propan-2-ylphenoxy)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1ccc(C(C)C)c(OCc2nn3c(-c4c(C)nc5ccccn45)nnc3s2)c1 |
| InChI | InChI=1S/C22H22N6OS/c1-13(2)16-9-8-14(3)11-17(16)29-12-19-26-28-21(24-25-22(28)30-19)20-15(4)23-18-7-5-6-10-27(18)20/h5-11,13H,12H2,1-4H3 |
| InChIKey | LGGMHRWEPNGQIG-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 69.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |