C17H18BrClN2O2 — CID 100828380
N-(4-amino-2-chloro-6-methylphenyl)-2-(4-bromophenoxy)-2-methylpropanamide (PubChem CID 100828380) has the molecular formula C17H18BrClN2O2 and a molecular weight of 397.70 g/mol. Its IUPAC name is N-(4-amino-2-chloro-6-methylphenyl)-2-(4-bromophenoxy)-2-methylpropanamide.
| Compound Name | N-(4-amino-2-chloro-6-methylphenyl)-2-(4-bromophenoxy)-2-methylpropanamide |
|---|---|
| PubChem CID | 100828380 |
| Molecular Formula | C17H18BrClN2O2 |
| Molecular Weight | 397.70 g/mol |
| Exact Mass | 396.02 |
| IUPAC Name | N-(4-amino-2-chloro-6-methylphenyl)-2-(4-bromophenoxy)-2-methylpropanamide |
| SMILES | Cc1cc(N)cc(Cl)c1NC(=O)C(C)(C)Oc1ccc(Br)cc1 |
| InChI | InChI=1S/C17H18BrClN2O2/c1-10-8-12(20)9-14(19)15(10)21-16(22)17(2,3)23-13-6-4-11(18)5-7-13/h4-9H,20H2,1-3H3,(H,21,22) |
| InChIKey | GUCOZJRKUNLRPT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|