C11H9F3N2O — CID 10083078
4-benzyl-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one (PubChem CID 10083078) has the molecular formula C11H9F3N2O and a molecular weight of 242.20 g/mol. Its IUPAC name is 4-benzyl-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one.
| Compound Name | 4-benzyl-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 10083078 |
| Molecular Formula | C11H9F3N2O |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 4-benzyl-5-(trifluoromethyl)-1,2-dihydropyrazol-3-one |
| SMILES | O=c1[nH][nH]c(C(F)(F)F)c1Cc1ccccc1 |
| InChI | InChI=1S/C11H9F3N2O/c12-11(13,14)9-8(10(17)16-15-9)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,15,16,17) |
| InChIKey | PUTLIQUUCVJLFT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |