C17H24F3NO3 — CID 100835770
(2R)-1-[(3-methoxyphenyl)methoxy]-3-[(3R)-3-(trifluoromethyl)piperidin-1-yl]propan-2-ol (PubChem CID 100835770) has the molecular formula C17H24F3NO3 and a molecular weight of 347.38 g/mol. Its IUPAC name is (2R)-1-[(3-methoxyphenyl)methoxy]-3-[(3R)-3-(trifluoromethyl)piperidin-1-yl]propan-2-ol.
| Compound Name | (2R)-1-[(3-methoxyphenyl)methoxy]-3-[(3R)-3-(trifluoromethyl)piperidin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 100835770 |
| Molecular Formula | C17H24F3NO3 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2R)-1-[(3-methoxyphenyl)methoxy]-3-[(3R)-3-(trifluoromethyl)piperidin-1-yl]propan-2-ol |
| SMILES | COc1cccc(COC[C@H](O)CN2CCC[C@@H](C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C17H24F3NO3/c1-23-16-6-2-4-13(8-16)11-24-12-15(22)10-21-7-3-5-14(9-21)17(18,19)20/h2,4,6,8,14-15,22H,3,5,7,9-12H2,1H3/t14-,15-/m1/s1 |
| InChIKey | AJIPZNIXQABFPX-HUUCEWRRSA-N |
| XLogP | 2.85 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |