C21H29N3O3 — CID 134055442
1-[(3-methoxyphenyl)methoxy]-3-[4-(pyridin-2-ylmethyl)piperazin-1-yl]propan-2-ol (PubChem CID 134055442) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methoxy]-3-[4-(pyridin-2-ylmethyl)piperazin-1-yl]propan-2-ol.
| Compound Name | 1-[(3-methoxyphenyl)methoxy]-3-[4-(pyridin-2-ylmethyl)piperazin-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 134055442 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | 1-[(3-methoxyphenyl)methoxy]-3-[4-(pyridin-2-ylmethyl)piperazin-1-yl]propan-2-ol |
| SMILES | COc1cccc(COCC(O)CN2CCN(Cc3ccccn3)CC2)c1 |
| InChI | InChI=1S/C21H29N3O3/c1-26-21-7-4-5-18(13-21)16-27-17-20(25)15-24-11-9-23(10-12-24)14-19-6-2-3-8-22-19/h2-8,13,20,25H,9-12,14-17H2,1H3 |
| InChIKey | FXHGZBUFUUPAHH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |