C11H11F3N4 — CID 10083717
N-[2-(1H-imidazol-5-yl)ethyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 10083717) has the molecular formula C11H11F3N4 and a molecular weight of 256.23 g/mol. Its IUPAC name is N-[2-(1H-imidazol-5-yl)ethyl]-5-(trifluoromethyl)pyridin-2-amine.
| Compound Name | N-[2-(1H-imidazol-5-yl)ethyl]-5-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 10083717 |
| Molecular Formula | C11H11F3N4 |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.09 |
| IUPAC Name | N-[2-(1H-imidazol-5-yl)ethyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | FC(F)(F)c1ccc(NCCc2cnc[nH]2)nc1 |
| InChI | InChI=1S/C11H11F3N4/c12-11(13,14)8-1-2-10(17-5-8)16-4-3-9-6-15-7-18-9/h1-2,5-7H,3-4H2,(H,15,18)(H,16,17) |
| InChIKey | LUHMGMZOMQGWDC-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |