C15H21ClN2OS — CID 100838666
N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(5-chlorothiophen-2-yl)propanamide (PubChem CID 100838666) has the molecular formula C15H21ClN2OS and a molecular weight of 312.87 g/mol. Its IUPAC name is N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(5-chlorothiophen-2-yl)propanamide.
| Compound Name | N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(5-chlorothiophen-2-yl)propanamide |
|---|---|
| PubChem CID | 100838666 |
| Molecular Formula | C15H21ClN2OS |
| Molecular Weight | 312.87 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[(1S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl]-3-(5-chlorothiophen-2-yl)propanamide |
| SMILES | O=C(CCc1ccc(Cl)s1)N[C@H]1CCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C15H21ClN2OS/c16-14-6-4-11(20-14)5-7-15(19)17-12-8-10-18-9-2-1-3-13(12)18/h4,6,12-13H,1-3,5,7-10H2,(H,17,19)/t12-,13-/m0/s1 |
| InChIKey | YMLXGAZDSCTJJG-STQMWFEESA-N |
| XLogP | 3.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.87 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |