C16H18OS — CID 10083870
(2S,3aR)-2-ethenyl-3a-phenylsulfanyl-3,4,5,6-tetrahydro-2H-1-benzofuran (PubChem CID 10083870) has the molecular formula C16H18OS and a molecular weight of 258.39 g/mol. Its IUPAC name is (2S,3aR)-2-ethenyl-3a-phenylsulfanyl-3,4,5,6-tetrahydro-2H-1-benzofuran.
| Compound Name | (2S,3aR)-2-ethenyl-3a-phenylsulfanyl-3,4,5,6-tetrahydro-2H-1-benzofuran |
|---|---|
| PubChem CID | 10083870 |
| Molecular Formula | C16H18OS |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (2S,3aR)-2-ethenyl-3a-phenylsulfanyl-3,4,5,6-tetrahydro-2H-1-benzofuran |
| SMILES | C=C[C@@H]1C[C@]2(Sc3ccccc3)CCCC=C2O1 |
| InChI | InChI=1S/C16H18OS/c1-2-13-12-16(11-7-6-10-15(16)17-13)18-14-8-4-3-5-9-14/h2-5,8-10,13H,1,6-7,11-12H2/t13-,16-/m1/s1 |
| InChIKey | OMTOJUARVYUSOK-CZUORRHYSA-N |
| XLogP | 4.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|