C20H28FN5O2S — CID 100840720
(2S)-2-[[4-amino-5-[(2-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]propanamide (PubChem CID 100840720) has the molecular formula C20H28FN5O2S and a molecular weight of 421.54 g/mol. Its IUPAC name is (2S)-2-[[4-amino-5-[(2-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]propanamide.
| Compound Name | (2S)-2-[[4-amino-5-[(2-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 100840720 |
| Molecular Formula | C20H28FN5O2S |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | (2S)-2-[[4-amino-5-[(2-fluorophenoxy)methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-[(1R,2S,3R)-2,3-dimethylcyclohexyl]propanamide |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1NC(=O)[C@H](C)Sc1nnc(COc2ccccc2F)n1N |
| InChI | InChI=1S/C20H28FN5O2S/c1-12-7-6-9-16(13(12)2)23-19(27)14(3)29-20-25-24-18(26(20)22)11-28-17-10-5-4-8-15(17)21/h4-5,8,10,12-14,16H,6-7,9,11,22H2,1-3H3,(H,23,27)/t12-,13+,14+,16-/m1/s1 |
| InChIKey | UGWOALBBMXOSRI-ORIJERBGSA-N |
| XLogP | 3.13 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |