C22H28N6S — CID 100841780
3-[(2S)-4-methyl-2-phenylpiperazin-1-yl]-N-[(2-pyrimidin-2-yl-1,3-thiazol-4-yl)methyl]propan-1-amine (PubChem CID 100841780) has the molecular formula C22H28N6S and a molecular weight of 408.58 g/mol. Its IUPAC name is 3-[(2S)-4-methyl-2-phenylpiperazin-1-yl]-N-[(2-pyrimidin-2-yl-1,3-thiazol-4-yl)methyl]propan-1-amine.
| Compound Name | 3-[(2S)-4-methyl-2-phenylpiperazin-1-yl]-N-[(2-pyrimidin-2-yl-1,3-thiazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 100841780 |
| Molecular Formula | C22H28N6S |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | 3-[(2S)-4-methyl-2-phenylpiperazin-1-yl]-N-[(2-pyrimidin-2-yl-1,3-thiazol-4-yl)methyl]propan-1-amine |
| SMILES | CN1CCN(CCCNCc2csc(-c3ncccn3)n2)[C@@H](c2ccccc2)C1 |
| InChI | InChI=1S/C22H28N6S/c1-27-13-14-28(20(16-27)18-7-3-2-4-8-18)12-6-9-23-15-19-17-29-22(26-19)21-24-10-5-11-25-21/h2-5,7-8,10-11,17,20,23H,6,9,12-16H2,1H3/t20-/m1/s1 |
| InChIKey | LBIUZDZNVAJWBL-HXUWFJFHSA-N |
| XLogP | 3.07 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|