C15H24O2S — CID 10084415
1,1-di(propan-2-yloxy)propan-2-ylsulfanylbenzene (PubChem CID 10084415) has the molecular formula C15H24O2S and a molecular weight of 268.42 g/mol. Its IUPAC name is 1,1-di(propan-2-yloxy)propan-2-ylsulfanylbenzene.
| Compound Name | 1,1-di(propan-2-yloxy)propan-2-ylsulfanylbenzene |
|---|---|
| PubChem CID | 10084415 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1,1-di(propan-2-yloxy)propan-2-ylsulfanylbenzene |
| SMILES | CC(C)OC(OC(C)C)C(C)Sc1ccccc1 |
| InChI | InChI=1S/C15H24O2S/c1-11(2)16-15(17-12(3)4)13(5)18-14-9-7-6-8-10-14/h6-13,15H,1-5H3 |
| InChIKey | FNOORXPRWUIAOE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|