C16H26N2O2 — CID 100844187
2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[(1R,2S)-2-hydroxycyclopentyl]piperazin-1-yl]ethanone (PubChem CID 100844187) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[(1R,2S)-2-hydroxycyclopentyl]piperazin-1-yl]ethanone.
| Compound Name | 2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[(1R,2S)-2-hydroxycyclopentyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 100844187 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 2-[(1R)-cyclopent-2-en-1-yl]-1-[4-[(1R,2S)-2-hydroxycyclopentyl]piperazin-1-yl]ethanone |
| SMILES | O=C(C[C@@H]1C=CCC1)N1CCN([C@@H]2CCC[C@@H]2O)CC1 |
| InChI | InChI=1S/C16H26N2O2/c19-15-7-3-6-14(15)17-8-10-18(11-9-17)16(20)12-13-4-1-2-5-13/h1,4,13-15,19H,2-3,5-12H2/t13-,14-,15+/m1/s1 |
| InChIKey | YJBVQZBEMNUPMY-KFWWJZLASA-N |
| XLogP | 1.40 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|