C7H11IO3 — CID 10084467
(3R)-3-[(1R)-1-iodoethyl]-1,4-dioxepan-5-one (PubChem CID 10084467) has the molecular formula C7H11IO3 and a molecular weight of 270.07 g/mol. Its IUPAC name is (3R)-3-[(1R)-1-iodoethyl]-1,4-dioxepan-5-one.
| Compound Name | (3R)-3-[(1R)-1-iodoethyl]-1,4-dioxepan-5-one |
|---|---|
| PubChem CID | 10084467 |
| Molecular Formula | C7H11IO3 |
| Molecular Weight | 270.07 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | (3R)-3-[(1R)-1-iodoethyl]-1,4-dioxepan-5-one |
| SMILES | C[C@@H](I)[C@H]1COCCC(=O)O1 |
| InChI | InChI=1S/C7H11IO3/c1-5(8)6-4-10-3-2-7(9)11-6/h5-6H,2-4H2,1H3/t5-,6-/m1/s1 |
| InChIKey | XVQQBFGMKZJQDB-PHDIDXHHSA-N |
| XLogP | 1.14 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.07 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|