C20H20F2O5 — CID 141386227
7,8-bis(4-fluorophenoxy)-9-methyl-1,5-dioxonan-2-one (PubChem CID 141386227) has the molecular formula C20H20F2O5 and a molecular weight of 378.37 g/mol. Its IUPAC name is 7,8-bis(4-fluorophenoxy)-9-methyl-1,5-dioxonan-2-one.
| Compound Name | 7,8-bis(4-fluorophenoxy)-9-methyl-1,5-dioxonan-2-one |
|---|---|
| PubChem CID | 141386227 |
| Molecular Formula | C20H20F2O5 |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 7,8-bis(4-fluorophenoxy)-9-methyl-1,5-dioxonan-2-one |
| SMILES | CC1OC(=O)CCOCC(Oc2ccc(F)cc2)C1Oc1ccc(F)cc1 |
| InChI | InChI=1S/C20H20F2O5/c1-13-20(27-17-8-4-15(22)5-9-17)18(12-24-11-10-19(23)25-13)26-16-6-2-14(21)3-7-16/h2-9,13,18,20H,10-12H2,1H3 |
| InChIKey | HLEXBUPNCHSDGD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |